C28H22Cl4O4 — CID 134932797
dimethyl 21,22,23,24-tetrachloroundecacyclo[12.10.0.01,20.02,6.03,13.04,11.05,9.07,20.010,17.012,16.015,19]tetracosa-10,21,23-triene-3,8-dicarboxylate (PubChem CID 134932797) has the molecular formula C28H22Cl4O4 and a molecular weight of 564.29 g/mol. Its IUPAC name is dimethyl 21,22,23,24-tetrachloroundecacyclo[12.10.0.01,20.02,6.03,13.04,11.05,9.07,20.010,17.012,16.015,19]tetracosa-10,21,23-triene-3,8-dicarboxylate.
| Compound Name | dimethyl 21,22,23,24-tetrachloroundecacyclo[12.10.0.01,20.02,6.03,13.04,11.05,9.07,20.010,17.012,16.015,19]tetracosa-10,21,23-triene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 134932797 |
| Molecular Formula | C28H22Cl4O4 |
| Molecular Weight | 564.29 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | dimethyl 21,22,23,24-tetrachloroundecacyclo[12.10.0.01,20.02,6.03,13.04,11.05,9.07,20.010,17.012,16.015,19]tetracosa-10,21,23-triene-3,8-dicarboxylate |
| SMILES | COC(=O)C1C2C3=C4C5C6C3CC3C6C6C5C5(C(=O)OC)C4C2C2C1C31C(Cl)=C(Cl)C(Cl)=C(Cl)C61C25 |
| InChI | InChI=1S/C28H22Cl4O4/c1-35-24(33)14-9-7-4-3-5-8-6(4)11-10(7)15-12(9)13-16(14)27(5)22(31)19(29)20(30)23(32)28(27)18(8)17(11)26(15,21(13)28)25(34)36-2/h4-6,8-9,11-18,21H,3H2,1-2H3 |
| InChIKey | SCIUBVXKBUZRDY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|