C24H22O4 — CID 134879540
dimethyl decacyclo[9.9.0.02,18.03,10.04,17.05,9.06,16.07,14.08,12.013,20]icosa-4(17),12-diene-9,15-dicarboxylate (PubChem CID 134879540) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is dimethyl decacyclo[9.9.0.02,18.03,10.04,17.05,9.06,16.07,14.08,12.013,20]icosa-4(17),12-diene-9,15-dicarboxylate.
| Compound Name | dimethyl decacyclo[9.9.0.02,18.03,10.04,17.05,9.06,16.07,14.08,12.013,20]icosa-4(17),12-diene-9,15-dicarboxylate |
|---|---|
| PubChem CID | 134879540 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | dimethyl decacyclo[9.9.0.02,18.03,10.04,17.05,9.06,16.07,14.08,12.013,20]icosa-4(17),12-diene-9,15-dicarboxylate |
| SMILES | COC(=O)C1C2C3=C4C5C6C3CC3C7=C8C(C36)C5C3(C(=O)OC)C4C2C(C71)C83 |
| InChI | InChI=1S/C24H22O4/c1-27-22(25)18-10-8-4-3-5-7-6(4)12-14(8)20-16(10)17-11(18)9(5)15-13(7)19(12)24(20,21(15)17)23(26)28-2/h4-7,10-13,16-21H,3H2,1-2H3 |
| InChIKey | PTJNWDXIDBUFRJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|