C17H24O4 — CID 13426393
dimethyl (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylate (PubChem CID 13426393) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is dimethyl (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylate.
| Compound Name | dimethyl (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 13426393 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | dimethyl (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@]12CCC[C@@]1(C(=O)OC)[C@H]1CC[C@@H]2C1=C(C)C |
| InChI | InChI=1S/C17H24O4/c1-10(2)13-11-6-7-12(13)17(15(19)21-4)9-5-8-16(11,17)14(18)20-3/h11-12H,5-9H2,1-4H3/t11-,12+,16-,17+ |
| InChIKey | MOCDEHFLVLJCLV-OGRXGRENSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|