C24H20O6 — CID 14381389
dimethyl 13,18-dioxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate (PubChem CID 14381389) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is dimethyl 13,18-dioxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate.
| Compound Name | dimethyl 13,18-dioxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 14381389 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | dimethyl 13,18-dioxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
| SMILES | COC(=O)C1C2C3=C4C5C(=O)C6C7=C(C8C(=O)C3C5C86)C1C1C7C(C(=O)OC)C4C21 |
| InChI | InChI=1S/C24H20O6/c1-29-23(27)19-9-3-4-10(19)6-8-12(4)20(24(28)30-2)11(3)7-5(9)15-13-14(16(6)21(15)25)18(8)22(26)17(7)13/h3-4,9-20H,1-2H3 |
| InChIKey | FHSDRHMTABUBER-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|