C12H15F3O3 — CID 134933110
ethyl (1S,2S,4R)-2-(2,2,2-trifluoroacetyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 134933110) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is ethyl (1S,2S,4R)-2-(2,2,2-trifluoroacetyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1S,2S,4R)-2-(2,2,2-trifluoroacetyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 134933110 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | ethyl (1S,2S,4R)-2-(2,2,2-trifluoroacetyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(=O)C(F)(F)F)C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H15F3O3/c1-2-18-10(17)11(9(16)12(13,14)15)6-7-3-4-8(11)5-7/h7-8H,2-6H2,1H3/t7-,8+,11+/m1/s1 |
| InChIKey | SRZJTFZPHLOCKO-FYBVGQRMSA-N |
| XLogP | 2.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|