C15H28O3Si2 — CID 134934011
(3R,7R)-1,9-bis(trimethylsilyl)nona-1,8-diyne-3,5,7-triol (PubChem CID 134934011) has the molecular formula C15H28O3Si2 and a molecular weight of 312.56 g/mol. Its IUPAC name is (3R,7R)-1,9-bis(trimethylsilyl)nona-1,8-diyne-3,5,7-triol.
| Compound Name | (3R,7R)-1,9-bis(trimethylsilyl)nona-1,8-diyne-3,5,7-triol |
|---|---|
| PubChem CID | 134934011 |
| Molecular Formula | C15H28O3Si2 |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3R,7R)-1,9-bis(trimethylsilyl)nona-1,8-diyne-3,5,7-triol |
| SMILES | C[Si](C)(C)C#C[C@H](O)CC(O)C[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H28O3Si2/c1-19(2,3)9-7-13(16)11-15(18)12-14(17)8-10-20(4,5)6/h13-18H,11-12H2,1-6H3/t13-,14-/m0/s1 |
| InChIKey | PMERNZRRMZQFHD-KBPBESRZSA-N |
| XLogP | 1.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|