C21H40FNO3 — CID 134934921
tert-butyl (4S)-4-[(2S)-2-fluoroundecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134934921) has the molecular formula C21H40FNO3 and a molecular weight of 373.55 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(2S)-2-fluoroundecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(2S)-2-fluoroundecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134934921 |
| Molecular Formula | C21H40FNO3 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | tert-butyl (4S)-4-[(2S)-2-fluoroundecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCCCC[C@H](F)C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40FNO3/c1-7-8-9-10-11-12-13-14-17(22)15-18-16-25-21(5,6)23(18)19(24)26-20(2,3)4/h17-18H,7-16H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | ICEFCIVZUQTTAP-ROUUACIJSA-N |
| XLogP | 6.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|