C18H21F3O3S2 — CID 134935864
[bis(2,5-dimethylphenyl)-methyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 134935864) has the molecular formula C18H21F3O3S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is [bis(2,5-dimethylphenyl)-methyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis(2,5-dimethylphenyl)-methyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134935864 |
| Molecular Formula | C18H21F3O3S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [bis(2,5-dimethylphenyl)-methyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C)c(S(C)(OS(=O)(=O)C(F)(F)F)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C18H21F3O3S2/c1-12-6-8-14(3)16(10-12)25(5,24-26(22,23)18(19,20)21)17-11-13(2)7-9-15(17)4/h6-11H,1-5H3 |
| InChIKey | AUQYCUJAUHCYRV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|