C16H32O4 — CID 134936294
(2S,5S,6R)-2-methyl-6-[(4R,5R,6S)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,5-diol (PubChem CID 134936294) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2S,5S,6R)-2-methyl-6-[(4R,5R,6S)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,5-diol.
| Compound Name | (2S,5S,6R)-2-methyl-6-[(4R,5R,6S)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,5-diol |
|---|---|
| PubChem CID | 134936294 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (2S,5S,6R)-2-methyl-6-[(4R,5R,6S)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,5-diol |
| SMILES | C[C@H](CO)CC[C@H](O)[C@@H](C)[C@H]1OC(C)(C)O[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C16H32O4/c1-10(9-17)7-8-14(18)12(3)15-11(2)13(4)19-16(5,6)20-15/h10-15,17-18H,7-9H2,1-6H3/t10-,11+,12+,13-,14-,15-/m0/s1 |
| InChIKey | UIGQWHCQOPUJBN-RHTUOURWSA-N |
| XLogP | 2.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |