C13H15NO2 — CID 134936359
(1S,12R)-11,13-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-triene (PubChem CID 134936359) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (1S,12R)-11,13-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-triene.
| Compound Name | (1S,12R)-11,13-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134936359 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1S,12R)-11,13-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)CCN1O[C@H]3OCCC3[C@@H]21 |
| InChI | InChI=1S/C13H15NO2/c1-2-4-10-9(3-1)5-7-14-12(10)11-6-8-15-13(11)16-14/h1-4,11-13H,5-8H2/t11?,12-,13-/m1/s1 |
| InChIKey | FIRSORKOQHFGMX-VFRRUGBOSA-N |
| XLogP | 1.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |