C14H19NO3 — CID 134936607
(1S,10bS)-2,2-dimethoxy-1-methyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline (PubChem CID 134936607) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (1S,10bS)-2,2-dimethoxy-1-methyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline.
| Compound Name | (1S,10bS)-2,2-dimethoxy-1-methyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline |
|---|---|
| PubChem CID | 134936607 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (1S,10bS)-2,2-dimethoxy-1-methyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline |
| SMILES | COC1(OC)ON2CCc3ccccc3[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C14H19NO3/c1-10-13-12-7-5-4-6-11(12)8-9-15(13)18-14(10,16-2)17-3/h4-7,10,13H,8-9H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | LMVIWAUYYWVAPW-GWCFXTLKSA-N |
| XLogP | 2.11 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|