C19H23NO3 — CID 100957932
(3S,4S)-2-benzyl-5,5-dimethoxy-4-methyl-3-phenyl-1,2-oxazolidine (PubChem CID 100957932) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3S,4S)-2-benzyl-5,5-dimethoxy-4-methyl-3-phenyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-benzyl-5,5-dimethoxy-4-methyl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 100957932 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (3S,4S)-2-benzyl-5,5-dimethoxy-4-methyl-3-phenyl-1,2-oxazolidine |
| SMILES | COC1(OC)ON(Cc2ccccc2)[C@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C19H23NO3/c1-15-18(17-12-8-5-9-13-17)20(23-19(15,21-2)22-3)14-16-10-6-4-7-11-16/h4-13,15,18H,14H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | GKQUFUCCFMLODD-YJBOKZPZSA-N |
| XLogP | 3.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|