C17H19NOSe — CID 10903692
(3S,4S)-2-ethyl-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 10903692) has the molecular formula C17H19NOSe and a molecular weight of 332.31 g/mol. Its IUPAC name is (3S,4S)-2-ethyl-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-ethyl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10903692 |
| Molecular Formula | C17H19NOSe |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (3S,4S)-2-ethyl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CCN1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NOSe/c1-2-18-17(14-9-5-3-6-10-14)16(13-19-18)20-15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | RTXJSJKSKAFULB-SJORKVTESA-N |
| XLogP | 2.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|