C11H12F3NO — CID 15151214
(3R,4S)-2-methyl-3-phenyl-4-(trifluoromethyl)-1,2-oxazolidine (PubChem CID 15151214) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is (3R,4S)-2-methyl-3-phenyl-4-(trifluoromethyl)-1,2-oxazolidine.
| Compound Name | (3R,4S)-2-methyl-3-phenyl-4-(trifluoromethyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 15151214 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3R,4S)-2-methyl-3-phenyl-4-(trifluoromethyl)-1,2-oxazolidine |
| SMILES | CN1OC[C@@H](C(F)(F)F)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12F3NO/c1-15-10(8-5-3-2-4-6-8)9(7-16-15)11(12,13)14/h2-6,9-10H,7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | XCDOAVSHTKSXSN-ZJUUUORDSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |