C11H14INO — CID 11141200
(3R,5S)-5-(iodomethyl)-2-methyl-3-phenyl-1,2-oxazolidine (PubChem CID 11141200) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is (3R,5S)-5-(iodomethyl)-2-methyl-3-phenyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-5-(iodomethyl)-2-methyl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11141200 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (3R,5S)-5-(iodomethyl)-2-methyl-3-phenyl-1,2-oxazolidine |
| SMILES | CN1O[C@H](CI)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14INO/c1-13-11(7-10(8-12)14-13)9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | GLUREVKQMHSVBV-WDEREUQCSA-N |
| XLogP | 2.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|