C22H29NOSe — CID 15758445
(3S,4S)-2-heptan-4-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 15758445) has the molecular formula C22H29NOSe and a molecular weight of 402.44 g/mol. Its IUPAC name is (3S,4S)-2-heptan-4-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-heptan-4-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 15758445 |
| Molecular Formula | C22H29NOSe |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (3S,4S)-2-heptan-4-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CCCC(CCC)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H29NOSe/c1-3-11-19(12-4-2)23-22(18-13-7-5-8-14-18)21(17-24-23)25-20-15-9-6-10-16-20/h5-10,13-16,19,21-22H,3-4,11-12,17H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | QDGQPBNHDMKWJW-YADHBBJMSA-N |
| XLogP | 4.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|