C18H21NOSe — CID 15758443
(3S,4S)-3-phenyl-4-phenylselanyl-2-propan-2-yl-1,2-oxazolidine (PubChem CID 15758443) has the molecular formula C18H21NOSe and a molecular weight of 346.33 g/mol. Its IUPAC name is (3S,4S)-3-phenyl-4-phenylselanyl-2-propan-2-yl-1,2-oxazolidine.
| Compound Name | (3S,4S)-3-phenyl-4-phenylselanyl-2-propan-2-yl-1,2-oxazolidine |
|---|---|
| PubChem CID | 15758443 |
| Molecular Formula | C18H21NOSe |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (3S,4S)-3-phenyl-4-phenylselanyl-2-propan-2-yl-1,2-oxazolidine |
| SMILES | CC(C)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21NOSe/c1-14(2)19-18(15-9-5-3-6-10-15)17(13-20-19)21-16-11-7-4-8-12-16/h3-12,14,17-18H,13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | RCQDTUMZVDYLRE-MSOLQXFVSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|