C14H24O5S2 — CID 134936371
(3aR,6R,7aR)-6-methoxy-2,2-dimethyl-7-(2-methyl-1,3-dithian-2-yl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 134936371) has the molecular formula C14H24O5S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (3aR,6R,7aR)-6-methoxy-2,2-dimethyl-7-(2-methyl-1,3-dithian-2-yl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,6R,7aR)-6-methoxy-2,2-dimethyl-7-(2-methyl-1,3-dithian-2-yl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 134936371 |
| Molecular Formula | C14H24O5S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (3aR,6R,7aR)-6-methoxy-2,2-dimethyl-7-(2-methyl-1,3-dithian-2-yl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CO[C@@H]1OC[C@H]2OC(C)(C)O[C@H]2C1(O)C1(C)SCCCS1 |
| InChI | InChI=1S/C14H24O5S2/c1-12(2)18-9-8-17-11(16-4)14(15,10(9)19-12)13(3)20-6-5-7-21-13/h9-11,15H,5-8H2,1-4H3/t9-,10-,11-,14?/m1/s1 |
| InChIKey | AEMCQYGCDKKNTG-POGOCJABSA-N |
| XLogP | 1.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |