C12H24O6S — CID 163425940
(2S,4R,5R)-2-(3-ethylsulfanylpropoxy)-6-(hydroxymethyl)-4-methyloxane-3,4,5-triol (PubChem CID 163425940) has the molecular formula C12H24O6S and a molecular weight of 296.39 g/mol. Its IUPAC name is (2S,4R,5R)-2-(3-ethylsulfanylpropoxy)-6-(hydroxymethyl)-4-methyloxane-3,4,5-triol.
| Compound Name | (2S,4R,5R)-2-(3-ethylsulfanylpropoxy)-6-(hydroxymethyl)-4-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 163425940 |
| Molecular Formula | C12H24O6S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S,4R,5R)-2-(3-ethylsulfanylpropoxy)-6-(hydroxymethyl)-4-methyloxane-3,4,5-triol |
| SMILES | CCSCCCO[C@H]1OC(CO)[C@@H](O)[C@@](C)(O)C1O |
| InChI | InChI=1S/C12H24O6S/c1-3-19-6-4-5-17-11-10(15)12(2,16)9(14)8(7-13)18-11/h8-11,13-16H,3-7H2,1-2H3/t8?,9-,10?,11+,12-/m1/s1 |
| InChIKey | AMNJXASBUKQLRE-MNRJGNLVSA-N |
| XLogP | -0.66 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|