methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate

C10H18O6S — CID 134936475

IUPACmethyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate
SMILESCOC(=O)[C@@H](OC(C)=O)SCCC(OC)OC
InChIInChI=1S/C10H18O6S/c1-7(11)16-10(9(12)15-4)17-6-5-8(13-2)14-3/h8,10H,5-6H2,1-4H3/t10-/m0/s1
InChIKeyGKJSZSKUFWIERZ-JTQLQIEISA-N
MW266.31 g/mol
LogP0.79
Rot. Bonds8

About methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate

methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate (PubChem CID 134936475) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate.

Molecular Properties

Compound Namemethyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate
PubChem CID134936475
Molecular FormulaC10H18O6S
Molecular Weight266.31 g/mol
Exact Mass266.08
IUPAC Namemethyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate
SMILESCOC(=O)[C@@H](OC(C)=O)SCCC(OC)OC
InChIInChI=1S/C10H18O6S/c1-7(11)16-10(9(12)15-4)17-6-5-8(13-2)14-3/h8,10H,5-6H2,1-4H3/t10-/m0/s1
InChIKeyGKJSZSKUFWIERZ-JTQLQIEISA-N
XLogP0.79
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.31
LogP ≤ 50.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate?
The IUPAC name of methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate (CID 134936475) is methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate.
What is the SMILES notation for methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate?
The canonical SMILES for methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate is COC(=O)[C@@H](OC(C)=O)SCCC(OC)OC.
What is the InChIKey of methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate?
The InChIKey is GKJSZSKUFWIERZ-JTQLQIEISA-N. The full InChI is InChI=1S/C10H18O6S/c1-7(11)16-10(9(12)15-4)17-6-5-8(13-2)14-3/h8,10H,5-6H2,1-4H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate?
methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate has a molecular weight of 266.31 g/mol, XLogP of 0.79, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate is sourced from PubChem (CID 134936475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).