C10H18O6S — CID 134936475
methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate (PubChem CID 134936475) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate.
| Compound Name | methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate |
|---|---|
| PubChem CID | 134936475 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl (2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)acetate |
| SMILES | COC(=O)[C@@H](OC(C)=O)SCCC(OC)OC |
| InChI | InChI=1S/C10H18O6S/c1-7(11)16-10(9(12)15-4)17-6-5-8(13-2)14-3/h8,10H,5-6H2,1-4H3/t10-/m0/s1 |
| InChIKey | GKJSZSKUFWIERZ-JTQLQIEISA-N |
| XLogP | 0.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|