C11H20O6S — CID 134986392
[(2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)ethyl] acetate (PubChem CID 134986392) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)ethyl] acetate.
| Compound Name | [(2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)ethyl] acetate |
|---|---|
| PubChem CID | 134986392 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [(2S)-2-acetyloxy-2-(3,3-dimethoxypropylsulfanyl)ethyl] acetate |
| SMILES | COC(CCS[C@@H](COC(C)=O)OC(C)=O)OC |
| InChI | InChI=1S/C11H20O6S/c1-8(12)16-7-11(17-9(2)13)18-6-5-10(14-3)15-4/h10-11H,5-7H2,1-4H3/t11-/m0/s1 |
| InChIKey | FEVHEXCKELVCJM-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|