C10H7FN4 — CID 134936496
(4-cyanoimino-5-fluoro-2,3-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 134936496) has the molecular formula C10H7FN4 and a molecular weight of 202.19 g/mol. Its IUPAC name is (4-cyanoimino-5-fluoro-2,3-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (4-cyanoimino-5-fluoro-2,3-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 134936496 |
| Molecular Formula | C10H7FN4 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (4-cyanoimino-5-fluoro-2,3-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CC1=C(C)/C(=N/C#N)C=C(F)/C1=N\C#N |
| InChI | InChI=1S/C10H7FN4/c1-6-7(2)10(15-5-13)8(11)3-9(6)14-4-12/h3H,1-2H3/b14-9+,15-10- |
| InChIKey | JHASPTDGAKHUDL-BMJMZVRVSA-N |
| XLogP | 2.03 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|