C10H5F3N4 — CID 640486
[4-cyanoimino-2-methyl-5-(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 640486) has the molecular formula C10H5F3N4 and a molecular weight of 238.17 g/mol. Its IUPAC name is [4-cyanoimino-2-methyl-5-(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [4-cyanoimino-2-methyl-5-(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 640486 |
| Molecular Formula | C10H5F3N4 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | [4-cyanoimino-2-methyl-5-(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | CC1=C/C(=N\C#N)C(C(F)(F)F)=C/C1=N\C#N |
| InChI | InChI=1S/C10H5F3N4/c1-6-2-9(17-5-15)7(10(11,12)13)3-8(6)16-4-14/h2-3H,1H3/b16-8+,17-9+ |
| InChIKey | AYIYHSFJCFAGPL-GONBZBRSSA-N |
| XLogP | 2.28 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|