C14H12ClNO3 — CID 134936527
2-[(Z)-butan-2-ylideneamino]oxy-3-chloronaphthalene-1,4-dione (PubChem CID 134936527) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-[(Z)-butan-2-ylideneamino]oxy-3-chloronaphthalene-1,4-dione.
| Compound Name | 2-[(Z)-butan-2-ylideneamino]oxy-3-chloronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 134936527 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(Z)-butan-2-ylideneamino]oxy-3-chloronaphthalene-1,4-dione |
| SMILES | CC/C(C)=N\OC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12ClNO3/c1-3-8(2)16-19-14-11(15)12(17)9-6-4-5-7-10(9)13(14)18/h4-7H,3H2,1-2H3/b16-8- |
| InChIKey | MAKBZQKOHSXGBK-PXNMLYILSA-N |
| XLogP | 3.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|