C19H38O3Si — CID 134937000
tert-butyl-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]butoxy]-dimethylsilane (PubChem CID 134937000) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is tert-butyl-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134937000 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl-[4-[(2R,6S)-1,7-dioxaspiro[5.5]undecan-2-yl]butoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H]1CCC[C@]2(CCCCO2)O1 |
| InChI | InChI=1S/C19H38O3Si/c1-18(2,3)23(4,5)21-16-8-6-11-17-12-10-14-19(22-17)13-7-9-15-20-19/h17H,6-16H2,1-5H3/t17-,19+/m1/s1 |
| InChIKey | RLLFJJJNMCTJFU-MJGOQNOKSA-N |
| XLogP | 5.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|