C12H14O2Te — CID 134938517
(3Z)-4-[(3E)-5-oxohexa-1,3-dien-3-yl]tellanylhexa-3,5-dien-2-one (PubChem CID 134938517) has the molecular formula C12H14O2Te and a molecular weight of 317.84 g/mol. Its IUPAC name is (3Z)-4-[(3E)-5-oxohexa-1,3-dien-3-yl]tellanylhexa-3,5-dien-2-one.
| Compound Name | (3Z)-4-[(3E)-5-oxohexa-1,3-dien-3-yl]tellanylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 134938517 |
| Molecular Formula | C12H14O2Te |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (3Z)-4-[(3E)-5-oxohexa-1,3-dien-3-yl]tellanylhexa-3,5-dien-2-one |
| SMILES | C=C/C(=C/C(C)=O)[Te]/C(C=C)=C/C(C)=O |
| InChI | InChI=1S/C12H14O2Te/c1-5-11(7-9(3)13)15-12(6-2)8-10(4)14/h5-8H,1-2H2,3-4H3/b11-7-,12-8+ |
| InChIKey | XIWUOHJQUGGUFD-NTLHZVPKSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|