C31H52O5Si2 — CID 134939004
methyl (2E)-2-[(2Z)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-5-phenylmethoxypentoxy]-6-trimethylsilylhepta-2,6-dienoate (PubChem CID 134939004) has the molecular formula C31H52O5Si2 and a molecular weight of 560.92 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-5-phenylmethoxypentoxy]-6-trimethylsilylhepta-2,6-dienoate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-5-phenylmethoxypentoxy]-6-trimethylsilylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 134939004 |
| Molecular Formula | C31H52O5Si2 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-5-phenylmethoxypentoxy]-6-trimethylsilylhepta-2,6-dienoate |
| SMILES | C=C(CC/C=C(/OC/C(=C\CO[Si](C)(C)C(C)(C)C)CCCOCc1ccccc1)C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C31H52O5Si2/c1-26(37(6,7)8)16-14-20-29(30(32)33-5)35-25-28(21-23-36-38(9,10)31(2,3)4)19-15-22-34-24-27-17-12-11-13-18-27/h11-13,17-18,20-21H,1,14-16,19,22-25H2,2-10H3/b28-21-,29-20+ |
| InChIKey | JCKIOUYTMJXZTK-JGFBIICISA-N |
| XLogP | 8.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|