C25H45NO8Si — CID 134939044
1-O-tert-butyl 2-O-ethyl (2R,3S,4R)-2-[(1S)-1-acetyloxy-2-methylpropyl]-4-methyl-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 134939044) has the molecular formula C25H45NO8Si and a molecular weight of 515.72 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,3S,4R)-2-[(1S)-1-acetyloxy-2-methylpropyl]-4-methyl-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,3S,4R)-2-[(1S)-1-acetyloxy-2-methylpropyl]-4-methyl-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134939044 |
| Molecular Formula | C25H45NO8Si |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,3S,4R)-2-[(1S)-1-acetyloxy-2-methylpropyl]-4-methyl-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H](OC(C)=O)C(C)C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H45NO8Si/c1-12-31-22(29)25(19(16(5)6)32-18(8)27)20(34-35(13-2,14-3)15-4)17(7)21(28)26(25)23(30)33-24(9,10)11/h16-17,19-20H,12-15H2,1-11H3/t17-,19+,20+,25-/m1/s1 |
| InChIKey | XDHKDOWVABTDMH-OAWZGRKZSA-N |
| XLogP | 4.68 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|