C24H43NO8Si — CID 134939056
1-O-tert-butyl 2-O-ethyl (2R,3S)-2-[(1S)-1-acetyloxy-2-methylpropyl]-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 134939056) has the molecular formula C24H43NO8Si and a molecular weight of 501.69 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,3S)-2-[(1S)-1-acetyloxy-2-methylpropyl]-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,3S)-2-[(1S)-1-acetyloxy-2-methylpropyl]-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134939056 |
| Molecular Formula | C24H43NO8Si |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,3S)-2-[(1S)-1-acetyloxy-2-methylpropyl]-5-oxo-3-triethylsilyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H](OC(C)=O)C(C)C)[C@@H](O[Si](CC)(CC)CC)CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43NO8Si/c1-11-30-21(28)24(20(16(5)6)31-17(7)26)18(33-34(12-2,13-3)14-4)15-19(27)25(24)22(29)32-23(8,9)10/h16,18,20H,11-15H2,1-10H3/t18-,20-,24-/m0/s1 |
| InChIKey | MHDJBERNYQCOHK-WXVUKLJWSA-N |
| XLogP | 4.43 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|