C17H26F2N3Si2- — CID 134939373
1,1-difluoro-1-[2-(pyrazol-1-ylmethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine (PubChem CID 134939373) has the molecular formula C17H26F2N3Si2- and a molecular weight of 366.58 g/mol. Its IUPAC name is 1,1-difluoro-1-[2-(pyrazol-1-ylmethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1,1-difluoro-1-[2-(pyrazol-1-ylmethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 134939373 |
| Molecular Formula | C17H26F2N3Si2- |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1,1-difluoro-1-[2-(pyrazol-1-ylmethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine |
| SMILES | C[Si](C)(C)N(C(F)(F)c1ccccc1[CH-]n1cccn1)[Si](C)(C)C |
| InChI | InChI=1S/C17H26F2N3Si2/c1-23(2,3)22(24(4,5)6)17(18,19)16-11-8-7-10-15(16)14-21-13-9-12-20-21/h7-14H,1-6H3/q-1 |
| InChIKey | QXGSAGXPWFBQKO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|