C37H52O2Sn — CID 134940422
(Z,2S)-6-tributylstannyl-1-trityloxyhex-4-en-2-ol (PubChem CID 134940422) has the molecular formula C37H52O2Sn and a molecular weight of 647.53 g/mol. Its IUPAC name is (Z,2S)-6-tributylstannyl-1-trityloxyhex-4-en-2-ol.
| Compound Name | (Z,2S)-6-tributylstannyl-1-trityloxyhex-4-en-2-ol |
|---|---|
| PubChem CID | 134940422 |
| Molecular Formula | C37H52O2Sn |
| Molecular Weight | 647.53 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | (Z,2S)-6-tributylstannyl-1-trityloxyhex-4-en-2-ol |
| SMILES | CCCC[Sn](C/C=C\C[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1)(CCCC)CCCC |
| InChI | InChI=1S/C25H25O2.3C4H9.Sn/c1-2-3-19-24(26)20-27-25(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;3*1-3-4-2;/h2-18,24,26H,1,19-20H2;3*1,3-4H2,2H3;/b3-2-;;;;/t24-;;;;/m0..../s1 |
| InChIKey | ZACMXYQZPCFCAJ-VWXMKOEGSA-N |
| XLogP | 10.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.53 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|