C24H30NO5Zn- — CID 134941119
ethane;ethyl 2-[(3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-2-oxo-4-phenylpiperidin-3-yl]acetate;zinc (PubChem CID 134941119) has the molecular formula C24H30NO5Zn- and a molecular weight of 477.90 g/mol. Its IUPAC name is ethane;ethyl 2-[(3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-2-oxo-4-phenylpiperidin-3-yl]acetate;zinc.
| Compound Name | ethane;ethyl 2-[(3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-2-oxo-4-phenylpiperidin-3-yl]acetate;zinc |
|---|---|
| PubChem CID | 134941119 |
| Molecular Formula | C24H30NO5Zn- |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | ethane;ethyl 2-[(3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-2-oxo-4-phenylpiperidin-3-yl]acetate;zinc |
| SMILES | CCOC(=O)C[C@H]1C(=O)N(c2ccc(OC)cc2)CC[C@]1(O)c1ccccc1.[CH2-]C.[Zn] |
| InChI | InChI=1S/C22H25NO5.C2H5.Zn/c1-3-28-20(24)15-19-21(25)23(17-9-11-18(27-2)12-10-17)14-13-22(19,26)16-7-5-4-6-8-16;1-2;/h4-12,19,26H,3,13-15H2,1-2H3;1H2,2H3;/q;-1;/t19-,22-;;/m0../s1 |
| InChIKey | BPMDCXGVEWJWSB-VVJLZRNGSA-N |
| XLogP | 3.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|