C17H22N2O4 — CID 134941228
ethyl (E)-3-[1-(dimethylcarbamoyl)-6-methoxy-2,3-dihydroindol-2-yl]prop-2-enoate (PubChem CID 134941228) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl (E)-3-[1-(dimethylcarbamoyl)-6-methoxy-2,3-dihydroindol-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-(dimethylcarbamoyl)-6-methoxy-2,3-dihydroindol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134941228 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl (E)-3-[1-(dimethylcarbamoyl)-6-methoxy-2,3-dihydroindol-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1Cc2ccc(OC)cc2N1C(=O)N(C)C |
| InChI | InChI=1S/C17H22N2O4/c1-5-23-16(20)9-7-13-10-12-6-8-14(22-4)11-15(12)19(13)17(21)18(2)3/h6-9,11,13H,5,10H2,1-4H3/b9-7+ |
| InChIKey | HEFVKZKDCNOVOP-VQHVLOKHSA-N |
| XLogP | 2.23 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|