C24H29ClNO5P — CID 134941480
methyl (2S,3R)-2-(3-chlorophenyl)-1-diethoxyphosphoryl-5-methylidene-3-phenylpiperidine-3-carboxylate (PubChem CID 134941480) has the molecular formula C24H29ClNO5P and a molecular weight of 477.93 g/mol. Its IUPAC name is methyl (2S,3R)-2-(3-chlorophenyl)-1-diethoxyphosphoryl-5-methylidene-3-phenylpiperidine-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-(3-chlorophenyl)-1-diethoxyphosphoryl-5-methylidene-3-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134941480 |
| Molecular Formula | C24H29ClNO5P |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | methyl (2S,3R)-2-(3-chlorophenyl)-1-diethoxyphosphoryl-5-methylidene-3-phenylpiperidine-3-carboxylate |
| SMILES | C=C1CN(P(=O)(OCC)OCC)[C@@H](c2cccc(Cl)c2)[C@](C(=O)OC)(c2ccccc2)C1 |
| InChI | InChI=1S/C24H29ClNO5P/c1-5-30-32(28,31-6-2)26-17-18(3)16-24(23(27)29-4,20-12-8-7-9-13-20)22(26)19-11-10-14-21(25)15-19/h7-15,22H,3,5-6,16-17H2,1-2,4H3/t22-,24+/m0/s1 |
| InChIKey | KOYJBPVYPOLCGD-LADGPHEKSA-N |
| XLogP | 5.94 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|