C28H33N3O3S — CID 134942180
N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-4-ethylbenzenesulfonamide (PubChem CID 134942180) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134942180 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-4-ethylbenzenesulfonamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NS(=O)(=O)c1ccc(CC)cc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H33N3O3S/c1-4-19-6-9-23(10-7-19)35(32,33)30-28(27-16-21-13-15-31(27)18-20(21)5-2)24-12-14-29-26-11-8-22(34-3)17-25(24)26/h5-12,14,17,20-21,27-28,30H,2,4,13,15-16,18H2,1,3H3/t20?,21?,27?,28-/m0/s1 |
| InChIKey | SGIZZRJOXALWGQ-YXHBXGEOSA-N |
| XLogP | 4.72 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|