C24H32N4O2 — CID 101209611
1-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-propylurea (PubChem CID 101209611) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-propylurea.
| Compound Name | 1-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-propylurea |
|---|---|
| PubChem CID | 101209611 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-propylurea |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](NC(=O)NCCC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H32N4O2/c1-4-10-26-24(29)27-23(22-13-17-9-12-28(22)15-16(17)5-2)19-8-11-25-21-7-6-18(30-3)14-20(19)21/h5-8,11,14,16-17,22-23H,2,4,9-10,12-13,15H2,1,3H3,(H2,26,27,29)/t16-,17-,22-,23+/m0/s1 |
| InChIKey | VCMZXZZHTGXCLM-BSWISCRUSA-N |
| XLogP | 3.89 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|