C27H32N6O — CID 177425850
2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]-(propylamino)methylidene]propanedinitrile (PubChem CID 177425850) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]-(propylamino)methylidene]propanedinitrile.
| Compound Name | 2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]-(propylamino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 177425850 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]-(propylamino)methylidene]propanedinitrile |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](NC(NCCC)=C(C#N)C#N)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C27H32N6O/c1-4-10-31-27(20(15-28)16-29)32-26(25-13-19-9-12-33(25)17-18(19)5-2)22-8-11-30-24-7-6-21(34-3)14-23(22)24/h5-8,11,14,18-19,25-26,31-32H,2,4,9-10,12-13,17H2,1,3H3/t18-,19-,25-,26-/m0/s1 |
| InChIKey | KIHXQGMQWUCAKE-KBFVSZBXSA-N |
| XLogP | 4.03 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|