C26H27BrN4O2 — CID 163297584
5-bromo-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]pyridine-2-carboxamide (PubChem CID 163297584) has the molecular formula C26H27BrN4O2 and a molecular weight of 507.43 g/mol. Its IUPAC name is 5-bromo-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163297584 |
| Molecular Formula | C26H27BrN4O2 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 5-bromo-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]pyridine-2-carboxamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1ccc(Br)cn1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H27BrN4O2/c1-3-16-15-31-11-9-17(16)12-24(31)25(30-26(32)23-6-4-18(27)14-29-23)20-8-10-28-22-7-5-19(33-2)13-21(20)22/h3-8,10,13-14,16-17,24-25H,1,9,11-12,15H2,2H3,(H,30,32)/t16?,17?,24?,25-/m0/s1 |
| InChIKey | APFZUNDKKLNDFQ-ZWNNSKJJSA-N |
| XLogP | 4.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|