C12H16O — CID 134942692
6,6-dimethyl-7,9a-dihydro-1H-cyclohepta[c]pyran (PubChem CID 134942692) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 6,6-dimethyl-7,9a-dihydro-1H-cyclohepta[c]pyran.
| Compound Name | 6,6-dimethyl-7,9a-dihydro-1H-cyclohepta[c]pyran |
|---|---|
| PubChem CID | 134942692 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 6,6-dimethyl-7,9a-dihydro-1H-cyclohepta[c]pyran |
| SMILES | CC1(C)C=C2C=COCC2C=CC1 |
| InChI | InChI=1S/C12H16O/c1-12(2)6-3-4-11-9-13-7-5-10(11)8-12/h3-5,7-8,11H,6,9H2,1-2H3 |
| InChIKey | MSFOVAHXLNWNQF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|