C29H29NO6 — CID 134943134
diethyl 2-benzamido-2-(3-oxo-1,3-diphenylpropyl)propanedioate (PubChem CID 134943134) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is diethyl 2-benzamido-2-(3-oxo-1,3-diphenylpropyl)propanedioate.
| Compound Name | diethyl 2-benzamido-2-(3-oxo-1,3-diphenylpropyl)propanedioate |
|---|---|
| PubChem CID | 134943134 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | diethyl 2-benzamido-2-(3-oxo-1,3-diphenylpropyl)propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)(C(=O)OCC)C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO6/c1-3-35-27(33)29(28(34)36-4-2,30-26(32)23-18-12-7-13-19-23)24(21-14-8-5-9-15-21)20-25(31)22-16-10-6-11-17-22/h5-19,24H,3-4,20H2,1-2H3,(H,30,32) |
| InChIKey | LYGHHBPKEWKWMU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|