C15H17F3O3 — CID 134943694
ethyl (2S)-2-hydroxy-3-methyl-4-phenyl-2-(trifluoromethyl)pent-4-enoate (PubChem CID 134943694) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-3-methyl-4-phenyl-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (2S)-2-hydroxy-3-methyl-4-phenyl-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 134943694 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl (2S)-2-hydroxy-3-methyl-4-phenyl-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C(c1ccccc1)C(C)[C@](O)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O3/c1-4-21-13(19)14(20,15(16,17)18)11(3)10(2)12-8-6-5-7-9-12/h5-9,11,20H,2,4H2,1,3H3/t11?,14-/m0/s1 |
| InChIKey | KOGCCLOQXDZJJV-IAXJKZSUSA-N |
| XLogP | 3.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |