C44H34P2Pd+4 — CID 134943742
[1-(2-diphenylphosphaniumylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphanium;palladium(2+) (PubChem CID 134943742) has the molecular formula C44H34P2Pd+4 and a molecular weight of 731.12 g/mol. Its IUPAC name is [1-(2-diphenylphosphaniumylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphanium;palladium(2+).
| Compound Name | [1-(2-diphenylphosphaniumylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphanium;palladium(2+) |
|---|---|
| PubChem CID | 134943742 |
| Molecular Formula | C44H34P2Pd+4 |
| Molecular Weight | 731.12 g/mol |
| Exact Mass | 730.11 |
| IUPAC Name | [1-(2-diphenylphosphaniumylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphanium;palladium(2+) |
| SMILES | [Pd+2].c1ccc([PH+](c2ccccc2)c2ccc3ccccc3c2-c2c([PH+](c3ccccc3)c3ccccc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C44H32P2.Pd/c1-5-19-35(20-6-1)45(36-21-7-2-8-22-36)41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)46(37-23-9-3-10-24-37)38-25-11-4-12-26-38;/h1-32H;/q;+2/p+2 |
| InChIKey | LOHPAPNCYZJBKJ-UHFFFAOYSA-P |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.12 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|