C19H29Br2NO2 — CID 134944015
tert-butyl (1S,4S,6R,8R,9S,11R,13R)-10,10-dibromo-6,11-dimethyl-3-azatetracyclo[6.3.2.04,13.09,11]tridecane-3-carboxylate (PubChem CID 134944015) has the molecular formula C19H29Br2NO2 and a molecular weight of 463.25 g/mol. Its IUPAC name is tert-butyl (1S,4S,6R,8R,9S,11R,13R)-10,10-dibromo-6,11-dimethyl-3-azatetracyclo[6.3.2.04,13.09,11]tridecane-3-carboxylate.
| Compound Name | tert-butyl (1S,4S,6R,8R,9S,11R,13R)-10,10-dibromo-6,11-dimethyl-3-azatetracyclo[6.3.2.04,13.09,11]tridecane-3-carboxylate |
|---|---|
| PubChem CID | 134944015 |
| Molecular Formula | C19H29Br2NO2 |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | tert-butyl (1S,4S,6R,8R,9S,11R,13R)-10,10-dibromo-6,11-dimethyl-3-azatetracyclo[6.3.2.04,13.09,11]tridecane-3-carboxylate |
| SMILES | C[C@@H]1C[C@@H]2[C@H]3C[C@H](CN(C(=O)OC(C)(C)C)[C@H]3C1)[C@]1(C)[C@H]2C1(Br)Br |
| InChI | InChI=1S/C19H29Br2NO2/c1-10-6-13-12-8-11(18(5)15(13)19(18,20)21)9-22(14(12)7-10)16(23)24-17(2,3)4/h10-15H,6-9H2,1-5H3/t10-,11-,12-,13-,14+,15+,18-/m1/s1 |
| InChIKey | PGVMSWOUVHOMIG-VLCURSHGSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|