C22H32N2O3 — CID 139115624
tert-butyl (1S,9S,11S,13S,17R)-5-methoxy-11-methyl-6,14-diazatetracyclo[7.6.2.02,7.013,17]heptadeca-2(7),3,5-triene-14-carboxylate (PubChem CID 139115624) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl (1S,9S,11S,13S,17R)-5-methoxy-11-methyl-6,14-diazatetracyclo[7.6.2.02,7.013,17]heptadeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9S,11S,13S,17R)-5-methoxy-11-methyl-6,14-diazatetracyclo[7.6.2.02,7.013,17]heptadeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 139115624 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl (1S,9S,11S,13S,17R)-5-methoxy-11-methyl-6,14-diazatetracyclo[7.6.2.02,7.013,17]heptadeca-2(7),3,5-triene-14-carboxylate |
| SMILES | COc1ccc2c(n1)C[C@@H]1C[C@H](C)C[C@H]3[C@@H]1C[C@@H]2CN3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O3/c1-13-8-14-11-18-16(6-7-20(23-18)26-5)15-10-17(14)19(9-13)24(12-15)21(25)27-22(2,3)4/h6-7,13-15,17,19H,8-12H2,1-5H3/t13-,14-,15+,17+,19-/m0/s1 |
| InChIKey | SXDYPPYQAVOTRR-LSIDRNEPSA-N |
| XLogP | 4.40 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |