C39H42N4 — CID 134944053
3,5-bis[(3,4-diethyl-1H-pyrrol-2-yl)-phenylmethyl]-4-phenyl-1H-pyrazole (PubChem CID 134944053) has the molecular formula C39H42N4 and a molecular weight of 566.79 g/mol. Its IUPAC name is 3,5-bis[(3,4-diethyl-1H-pyrrol-2-yl)-phenylmethyl]-4-phenyl-1H-pyrazole.
| Compound Name | 3,5-bis[(3,4-diethyl-1H-pyrrol-2-yl)-phenylmethyl]-4-phenyl-1H-pyrazole |
|---|---|
| PubChem CID | 134944053 |
| Molecular Formula | C39H42N4 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 3,5-bis[(3,4-diethyl-1H-pyrrol-2-yl)-phenylmethyl]-4-phenyl-1H-pyrazole |
| SMILES | CCc1c[nH]c(C(c2ccccc2)c2n[nH]c(C(c3ccccc3)c3[nH]cc(CC)c3CC)c2-c2ccccc2)c1CC |
| InChI | InChI=1S/C39H42N4/c1-5-26-24-40-36(31(26)7-3)33(28-18-12-9-13-19-28)38-35(30-22-16-11-17-23-30)39(43-42-38)34(29-20-14-10-15-21-29)37-32(8-4)27(6-2)25-41-37/h9-25,33-34,40-41H,5-8H2,1-4H3,(H,42,43) |
| InChIKey | HKZQRNRYCYOJRF-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |