C14H20O3 — CID 134945180
(4aR,8aS)-5-(hydroxymethyl)-2,5,8a-trimethyl-4,4a,7,8-tetrahydronaphthalene-1,6-dione (PubChem CID 134945180) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4aR,8aS)-5-(hydroxymethyl)-2,5,8a-trimethyl-4,4a,7,8-tetrahydronaphthalene-1,6-dione.
| Compound Name | (4aR,8aS)-5-(hydroxymethyl)-2,5,8a-trimethyl-4,4a,7,8-tetrahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 134945180 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4aR,8aS)-5-(hydroxymethyl)-2,5,8a-trimethyl-4,4a,7,8-tetrahydronaphthalene-1,6-dione |
| SMILES | CC1=CC[C@H]2C(C)(CO)C(=O)CC[C@]2(C)C1=O |
| InChI | InChI=1S/C14H20O3/c1-9-4-5-10-13(2,12(9)17)7-6-11(16)14(10,3)8-15/h4,10,15H,5-8H2,1-3H3/t10-,13+,14?/m1/s1 |
| InChIKey | GFICZNSJTAAVAO-KDICNWRVSA-N |
| XLogP | 1.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |