C26H28F2N2O6 — CID 134945267
ethyl (3S)-6-(1,3-dioxoisoindol-2-yl)-3-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-2,2-difluorohexanoate (PubChem CID 134945267) has the molecular formula C26H28F2N2O6 and a molecular weight of 502.51 g/mol. Its IUPAC name is ethyl (3S)-6-(1,3-dioxoisoindol-2-yl)-3-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-2,2-difluorohexanoate.
| Compound Name | ethyl (3S)-6-(1,3-dioxoisoindol-2-yl)-3-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-2,2-difluorohexanoate |
|---|---|
| PubChem CID | 134945267 |
| Molecular Formula | C26H28F2N2O6 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | ethyl (3S)-6-(1,3-dioxoisoindol-2-yl)-3-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-2,2-difluorohexanoate |
| SMILES | CCOC(=O)[C@H](N[C@@H](CCCN1C(=O)c2ccccc2C1=O)C(F)(F)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C26H28F2N2O6/c1-3-35-24(33)21(17-11-6-5-7-12-17)29-20(26(27,28)25(34)36-4-2)15-10-16-30-22(31)18-13-8-9-14-19(18)23(30)32/h5-9,11-14,20-21,29H,3-4,10,15-16H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | DTMSQRDVOSBLLJ-LEWJYISDSA-N |
| XLogP | 3.52 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|