C32H29NO2 — CID 134945301
(3R)-1-benzyl-3-(2-methylphenyl)-3-[(1R)-1-phenylmethoxyprop-2-enyl]indol-2-one (PubChem CID 134945301) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(2-methylphenyl)-3-[(1R)-1-phenylmethoxyprop-2-enyl]indol-2-one.
| Compound Name | (3R)-1-benzyl-3-(2-methylphenyl)-3-[(1R)-1-phenylmethoxyprop-2-enyl]indol-2-one |
|---|---|
| PubChem CID | 134945301 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (3R)-1-benzyl-3-(2-methylphenyl)-3-[(1R)-1-phenylmethoxyprop-2-enyl]indol-2-one |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@]1(c2ccccc2C)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H29NO2/c1-3-30(35-23-26-17-8-5-9-18-26)32(27-19-11-10-14-24(27)2)28-20-12-13-21-29(28)33(31(32)34)22-25-15-6-4-7-16-25/h3-21,30H,1,22-23H2,2H3/t30-,32-/m1/s1 |
| InChIKey | MKHZLTBZFPSOCK-XLJNKUFUSA-N |
| XLogP | 6.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|