C26H22Cl2F3NO2 — CID 139193542
(2'R,3S,5'S)-1-benzyl-5'-phenyl-2'-(trifluoromethyl)spiro[indole-3,3'-oxolane]-2-one;dichloromethane (PubChem CID 139193542) has the molecular formula C26H22Cl2F3NO2 and a molecular weight of 508.37 g/mol. Its IUPAC name is (2'R,3S,5'S)-1-benzyl-5'-phenyl-2'-(trifluoromethyl)spiro[indole-3,3'-oxolane]-2-one;dichloromethane.
| Compound Name | (2'R,3S,5'S)-1-benzyl-5'-phenyl-2'-(trifluoromethyl)spiro[indole-3,3'-oxolane]-2-one;dichloromethane |
|---|---|
| PubChem CID | 139193542 |
| Molecular Formula | C26H22Cl2F3NO2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | (2'R,3S,5'S)-1-benzyl-5'-phenyl-2'-(trifluoromethyl)spiro[indole-3,3'-oxolane]-2-one;dichloromethane |
| SMILES | ClCCl.O=C1N(Cc2ccccc2)c2ccccc2[C@]12C[C@@H](c1ccccc1)O[C@H]2C(F)(F)F |
| InChI | InChI=1S/C25H20F3NO2.CH2Cl2/c26-25(27,28)22-24(15-21(31-22)18-11-5-2-6-12-18)19-13-7-8-14-20(19)29(23(24)30)16-17-9-3-1-4-10-17;2-1-3/h1-14,21-22H,15-16H2;1H2/t21-,22+,24-;/m0./s1 |
| InChIKey | HCEPEKRWZRDPJD-USZKATPWSA-N |
| XLogP | 6.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|