C37H31NO2 — CID 134945298
(3R)-1-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-3-(4-phenylphenyl)indol-2-one (PubChem CID 134945298) has the molecular formula C37H31NO2 and a molecular weight of 521.66 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-3-(4-phenylphenyl)indol-2-one.
| Compound Name | (3R)-1-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-3-(4-phenylphenyl)indol-2-one |
|---|---|
| PubChem CID | 134945298 |
| Molecular Formula | C37H31NO2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (3R)-1-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-3-(4-phenylphenyl)indol-2-one |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@]1(c2ccc(-c3ccccc3)cc2)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C37H31NO2/c1-2-35(40-27-29-16-8-4-9-17-29)37(32-24-22-31(23-25-32)30-18-10-5-11-19-30)33-20-12-13-21-34(33)38(36(37)39)26-28-14-6-3-7-15-28/h2-25,35H,1,26-27H2/t35-,37-/m1/s1 |
| InChIKey | HDDMFJWFBMHPSZ-ZEEKBPLESA-N |
| XLogP | 7.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|